C15H12Cl2FN4P — CID 170446076
[5-(7,8-dichloro-3-fluoro-6-methyl-1,5-naphthyridin-2-yl)pyrimidin-2-yl]-dimethylphosphane (PubChem CID 170446076) has the molecular formula C15H12Cl2FN4P and a molecular weight of 369.17 g/mol. Its IUPAC name is [5-(7,8-dichloro-3-fluoro-6-methyl-1,5-naphthyridin-2-yl)pyrimidin-2-yl]-dimethylphosphane.
| Compound Name | [5-(7,8-dichloro-3-fluoro-6-methyl-1,5-naphthyridin-2-yl)pyrimidin-2-yl]-dimethylphosphane |
|---|---|
| PubChem CID | 170446076 |
| Molecular Formula | C15H12Cl2FN4P |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [5-(7,8-dichloro-3-fluoro-6-methyl-1,5-naphthyridin-2-yl)pyrimidin-2-yl]-dimethylphosphane |
| SMILES | Cc1nc2cc(F)c(-c3cnc(P(C)C)nc3)nc2c(Cl)c1Cl |
| InChI | InChI=1S/C15H12Cl2FN4P/c1-7-11(16)12(17)14-10(21-7)4-9(18)13(22-14)8-5-19-15(20-6-8)23(2)3/h4-6H,1-3H3 |
| InChIKey | WZXLKXHEZSWYPW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|