C16H14Cl2N3P — CID 170447427
[5-(7,8-dichloro-6-methyl-1,5-naphthyridin-2-yl)-2-pyridinyl]-dimethylphosphane (PubChem CID 170447427) has the molecular formula C16H14Cl2N3P and a molecular weight of 350.19 g/mol. Its IUPAC name is [5-(7,8-dichloro-6-methyl-1,5-naphthyridin-2-yl)-2-pyridinyl]-dimethylphosphane.
| Compound Name | [5-(7,8-dichloro-6-methyl-1,5-naphthyridin-2-yl)-2-pyridinyl]-dimethylphosphane |
|---|---|
| PubChem CID | 170447427 |
| Molecular Formula | C16H14Cl2N3P |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | [5-(7,8-dichloro-6-methyl-1,5-naphthyridin-2-yl)-2-pyridinyl]-dimethylphosphane |
| SMILES | Cc1nc2ccc(-c3ccc(P(C)C)nc3)nc2c(Cl)c1Cl |
| InChI | InChI=1S/C16H14Cl2N3P/c1-9-14(17)15(18)16-12(20-9)6-5-11(21-16)10-4-7-13(19-8-10)22(2)3/h4-8H,1-3H3 |
| InChIKey | QKSBLEKAKFJASP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|