C17H14Cl2FN2P — CID 170446520
[5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-dimethylphosphane (PubChem CID 170446520) has the molecular formula C17H14Cl2FN2P and a molecular weight of 367.19 g/mol. Its IUPAC name is [5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-dimethylphosphane.
| Compound Name | [5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-dimethylphosphane |
|---|---|
| PubChem CID | 170446520 |
| Molecular Formula | C17H14Cl2FN2P |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | [5-(3,4-dichloro-7-fluoro-2-methylquinolin-6-yl)-2-pyridinyl]-dimethylphosphane |
| SMILES | Cc1nc2cc(F)c(-c3ccc(P(C)C)nc3)cc2c(Cl)c1Cl |
| InChI | InChI=1S/C17H14Cl2FN2P/c1-9-16(18)17(19)12-6-11(13(20)7-14(12)22-9)10-4-5-15(21-8-10)23(2)3/h4-8H,1-3H3 |
| InChIKey | SUZWFVFSPJZJOT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|