C17H13Cl2F2N2OP — CID 170438239
3,4-dichloro-6-(6-dimethylphosphoryl-5-fluoro-3-pyridinyl)-7-fluoro-2-methylquinoline (PubChem CID 170438239) has the molecular formula C17H13Cl2F2N2OP and a molecular weight of 401.18 g/mol. Its IUPAC name is 3,4-dichloro-6-(6-dimethylphosphoryl-5-fluoro-3-pyridinyl)-7-fluoro-2-methylquinoline.
| Compound Name | 3,4-dichloro-6-(6-dimethylphosphoryl-5-fluoro-3-pyridinyl)-7-fluoro-2-methylquinoline |
|---|---|
| PubChem CID | 170438239 |
| Molecular Formula | C17H13Cl2F2N2OP |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 3,4-dichloro-6-(6-dimethylphosphoryl-5-fluoro-3-pyridinyl)-7-fluoro-2-methylquinoline |
| SMILES | Cc1nc2cc(F)c(-c3cnc(P(C)(C)=O)c(F)c3)cc2c(Cl)c1Cl |
| InChI | InChI=1S/C17H13Cl2F2N2OP/c1-8-15(18)16(19)11-5-10(12(20)6-14(11)23-8)9-4-13(21)17(22-7-9)25(2,3)24/h4-7H,1-3H3 |
| InChIKey | CXOHCJFIANAGKU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|