C7H5F4N — CID 118851823
2-(difluoromethyl)-4,6-difluoro-3-methylpyridine (PubChem CID 118851823) has the molecular formula C7H5F4N and a molecular weight of 179.12 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,6-difluoro-3-methylpyridine.
| Compound Name | 2-(difluoromethyl)-4,6-difluoro-3-methylpyridine |
|---|---|
| PubChem CID | 118851823 |
| Molecular Formula | C7H5F4N |
| Molecular Weight | 179.12 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2-(difluoromethyl)-4,6-difluoro-3-methylpyridine |
| SMILES | Cc1c(F)cc(F)nc1C(F)F |
| InChI | InChI=1S/C7H5F4N/c1-3-4(8)2-5(9)12-6(3)7(10)11/h2,7H,1H3 |
| InChIKey | WZJBTPBEIJOYPV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|