C6H2F5N — CID 130088806
3-(difluoromethyl)-2,4,6-trifluoropyridine (PubChem CID 130088806) has the molecular formula C6H2F5N and a molecular weight of 183.08 g/mol. Its IUPAC name is 3-(difluoromethyl)-2,4,6-trifluoropyridine.
| Compound Name | 3-(difluoromethyl)-2,4,6-trifluoropyridine |
|---|---|
| PubChem CID | 130088806 |
| Molecular Formula | C6H2F5N |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 3-(difluoromethyl)-2,4,6-trifluoropyridine |
| SMILES | Fc1cc(F)c(C(F)F)c(F)n1 |
| InChI | InChI=1S/C6H2F5N/c7-2-1-3(8)12-6(11)4(2)5(9)10/h1,5H |
| InChIKey | BAHNXALPIMWCNA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|