C7H3F4NO2 — CID 118823505
3-(difluoromethyl)-4,6-difluoropyridine-2-carboxylic acid (PubChem CID 118823505) has the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. Its IUPAC name is 3-(difluoromethyl)-4,6-difluoropyridine-2-carboxylic acid.
| Compound Name | 3-(difluoromethyl)-4,6-difluoropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118823505 |
| Molecular Formula | C7H3F4NO2 |
| Molecular Weight | 209.10 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 3-(difluoromethyl)-4,6-difluoropyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(F)cc(F)c1C(F)F |
| InChI | InChI=1S/C7H3F4NO2/c8-2-1-3(9)12-5(7(13)14)4(2)6(10)11/h1,6H,(H,13,14) |
| InChIKey | ASSNKJXYVKXACE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|