C6H2F4N2O2 — CID 118800101
3-(difluoromethyl)-4,6-difluoro-2-nitropyridine (PubChem CID 118800101) has the molecular formula C6H2F4N2O2 and a molecular weight of 210.09 g/mol. Its IUPAC name is 3-(difluoromethyl)-4,6-difluoro-2-nitropyridine.
| Compound Name | 3-(difluoromethyl)-4,6-difluoro-2-nitropyridine |
|---|---|
| PubChem CID | 118800101 |
| Molecular Formula | C6H2F4N2O2 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 3-(difluoromethyl)-4,6-difluoro-2-nitropyridine |
| SMILES | O=[N+]([O-])c1nc(F)cc(F)c1C(F)F |
| InChI | InChI=1S/C6H2F4N2O2/c7-2-1-3(8)11-6(12(13)14)4(2)5(9)10/h1,5H |
| InChIKey | SWEDEMCDEAEIHT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|