C6H2Br2F3N — CID 118998950
2,4-dibromo-3-(difluoromethyl)-6-fluoropyridine (PubChem CID 118998950) has the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. Its IUPAC name is 2,4-dibromo-3-(difluoromethyl)-6-fluoropyridine.
| Compound Name | 2,4-dibromo-3-(difluoromethyl)-6-fluoropyridine |
|---|---|
| PubChem CID | 118998950 |
| Molecular Formula | C6H2Br2F3N |
| Molecular Weight | 304.89 g/mol |
| Exact Mass | 302.85 |
| IUPAC Name | 2,4-dibromo-3-(difluoromethyl)-6-fluoropyridine |
| SMILES | Fc1cc(Br)c(C(F)F)c(Br)n1 |
| InChI | InChI=1S/C6H2Br2F3N/c7-2-1-3(9)12-5(8)4(2)6(10)11/h1,6H |
| InChIKey | UGOKAPSSAVUFFH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|