C6H2Br2ClF2N — CID 118834001
2,6-dibromo-4-chloro-3-(difluoromethyl)pyridine (PubChem CID 118834001) has the molecular formula C6H2Br2ClF2N and a molecular weight of 321.35 g/mol. Its IUPAC name is 2,6-dibromo-4-chloro-3-(difluoromethyl)pyridine.
| Compound Name | 2,6-dibromo-4-chloro-3-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 118834001 |
| Molecular Formula | C6H2Br2ClF2N |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 318.82 |
| IUPAC Name | 2,6-dibromo-4-chloro-3-(difluoromethyl)pyridine |
| SMILES | FC(F)c1c(Cl)cc(Br)nc1Br |
| InChI | InChI=1S/C6H2Br2ClF2N/c7-3-1-2(9)4(6(10)11)5(8)12-3/h1,6H |
| InChIKey | BVAMXKOTSSNOKK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|