C6H2BrCl2F2N — CID 119019803
2-bromo-3,5-dichloro-4-(difluoromethyl)pyridine (PubChem CID 119019803) has the molecular formula C6H2BrCl2F2N and a molecular weight of 276.89 g/mol. Its IUPAC name is 2-bromo-3,5-dichloro-4-(difluoromethyl)pyridine.
| Compound Name | 2-bromo-3,5-dichloro-4-(difluoromethyl)pyridine |
|---|---|
| PubChem CID | 119019803 |
| Molecular Formula | C6H2BrCl2F2N |
| Molecular Weight | 276.89 g/mol |
| Exact Mass | 274.87 |
| IUPAC Name | 2-bromo-3,5-dichloro-4-(difluoromethyl)pyridine |
| SMILES | FC(F)c1c(Cl)cnc(Br)c1Cl |
| InChI | InChI=1S/C6H2BrCl2F2N/c7-5-4(9)3(6(10)11)2(8)1-12-5/h1,6H |
| InChIKey | LIXVYJIASJBYDM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|