C6H2ClF2I2N — CID 130100430
5-chloro-4-(difluoromethyl)-2,3-diiodopyridine (PubChem CID 130100430) has the molecular formula C6H2ClF2I2N and a molecular weight of 415.35 g/mol. Its IUPAC name is 5-chloro-4-(difluoromethyl)-2,3-diiodopyridine.
| Compound Name | 5-chloro-4-(difluoromethyl)-2,3-diiodopyridine |
|---|---|
| PubChem CID | 130100430 |
| Molecular Formula | C6H2ClF2I2N |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.79 |
| IUPAC Name | 5-chloro-4-(difluoromethyl)-2,3-diiodopyridine |
| SMILES | FC(F)c1c(Cl)cnc(I)c1I |
| InChI | InChI=1S/C6H2ClF2I2N/c7-2-1-12-6(11)4(10)3(2)5(8)9/h1,5H |
| InChIKey | WNORUUWPHPTWPS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|