C6H4F2I2N2 — CID 130100391
4-(difluoromethyl)-5,6-diiodopyridin-3-amine (PubChem CID 130100391) has the molecular formula C6H4F2I2N2 and a molecular weight of 395.92 g/mol. Its IUPAC name is 4-(difluoromethyl)-5,6-diiodopyridin-3-amine.
| Compound Name | 4-(difluoromethyl)-5,6-diiodopyridin-3-amine |
|---|---|
| PubChem CID | 130100391 |
| Molecular Formula | C6H4F2I2N2 |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.84 |
| IUPAC Name | 4-(difluoromethyl)-5,6-diiodopyridin-3-amine |
| SMILES | Nc1cnc(I)c(I)c1C(F)F |
| InChI | InChI=1S/C6H4F2I2N2/c7-5(8)3-2(11)1-12-6(10)4(3)9/h1,5H,11H2 |
| InChIKey | RAZKUQIJIHEZNQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|