C6H6F2IN3O2S — CID 130105762
5-amino-4-(difluoromethyl)-2-iodopyridine-3-sulfonamide (PubChem CID 130105762) has the molecular formula C6H6F2IN3O2S and a molecular weight of 349.10 g/mol. Its IUPAC name is 5-amino-4-(difluoromethyl)-2-iodopyridine-3-sulfonamide.
| Compound Name | 5-amino-4-(difluoromethyl)-2-iodopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 130105762 |
| Molecular Formula | C6H6F2IN3O2S |
| Molecular Weight | 349.10 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 5-amino-4-(difluoromethyl)-2-iodopyridine-3-sulfonamide |
| SMILES | Nc1cnc(I)c(S(N)(=O)=O)c1C(F)F |
| InChI | InChI=1S/C6H6F2IN3O2S/c7-5(8)3-2(10)1-12-6(9)4(3)15(11,13)14/h1,5H,10H2,(H2,11,13,14) |
| InChIKey | DNYSFDZDHHOEND-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.10 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|