C6H4Cl2F2N2 — CID 119024495
4,5-dichloro-3-(difluoromethyl)pyridin-2-amine (PubChem CID 119024495) has the molecular formula C6H4Cl2F2N2 and a molecular weight of 213.01 g/mol. Its IUPAC name is 4,5-dichloro-3-(difluoromethyl)pyridin-2-amine.
| Compound Name | 4,5-dichloro-3-(difluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119024495 |
| Molecular Formula | C6H4Cl2F2N2 |
| Molecular Weight | 213.01 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 4,5-dichloro-3-(difluoromethyl)pyridin-2-amine |
| SMILES | Nc1ncc(Cl)c(Cl)c1C(F)F |
| InChI | InChI=1S/C6H4Cl2F2N2/c7-2-1-12-6(11)3(4(2)8)5(9)10/h1,5H,(H2,11,12) |
| InChIKey | ZKCDURIJSNPVQB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.01 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |