C6H4BrF2NO2 — CID 118999212
2-bromo-4-(difluoromethyl)pyridine-3,5-diol (PubChem CID 118999212) has the molecular formula C6H4BrF2NO2 and a molecular weight of 240.00 g/mol. Its IUPAC name is 2-bromo-4-(difluoromethyl)pyridine-3,5-diol.
| Compound Name | 2-bromo-4-(difluoromethyl)pyridine-3,5-diol |
|---|---|
| PubChem CID | 118999212 |
| Molecular Formula | C6H4BrF2NO2 |
| Molecular Weight | 240.00 g/mol |
| Exact Mass | 238.94 |
| IUPAC Name | 2-bromo-4-(difluoromethyl)pyridine-3,5-diol |
| SMILES | Oc1cnc(Br)c(O)c1C(F)F |
| InChI | InChI=1S/C6H4BrF2NO2/c7-5-4(12)3(6(8)9)2(11)1-10-5/h1,6,11-12H |
| InChIKey | ZCRPCHPRGSCNMF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.00 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|