C6H3F4NO — CID 130099609
5-(difluoromethyl)-4,6-difluoropyridin-3-ol (PubChem CID 130099609) has the molecular formula C6H3F4NO and a molecular weight of 181.09 g/mol. Its IUPAC name is 5-(difluoromethyl)-4,6-difluoropyridin-3-ol.
| Compound Name | 5-(difluoromethyl)-4,6-difluoropyridin-3-ol |
|---|---|
| PubChem CID | 130099609 |
| Molecular Formula | C6H3F4NO |
| Molecular Weight | 181.09 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 5-(difluoromethyl)-4,6-difluoropyridin-3-ol |
| SMILES | Oc1cnc(F)c(C(F)F)c1F |
| InChI | InChI=1S/C6H3F4NO/c7-4-2(12)1-11-6(10)3(4)5(8)9/h1,5,12H |
| InChIKey | MJLAINBNLZGNPE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.09 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|