C7H4BrF4N — CID 130099754
3-(bromomethyl)-2-(difluoromethyl)-4,6-difluoropyridine (PubChem CID 130099754) has the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. Its IUPAC name is 3-(bromomethyl)-2-(difluoromethyl)-4,6-difluoropyridine.
| Compound Name | 3-(bromomethyl)-2-(difluoromethyl)-4,6-difluoropyridine |
|---|---|
| PubChem CID | 130099754 |
| Molecular Formula | C7H4BrF4N |
| Molecular Weight | 258.01 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | 3-(bromomethyl)-2-(difluoromethyl)-4,6-difluoropyridine |
| SMILES | Fc1cc(F)c(CBr)c(C(F)F)n1 |
| InChI | InChI=1S/C7H4BrF4N/c8-2-3-4(9)1-5(10)13-6(3)7(11)12/h1,7H,2H2 |
| InChIKey | YJECALNRRJJNAX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.01 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|