C7H5F4N — CID 130099696
2-(difluoromethyl)-3,6-difluoro-5-methylpyridine (PubChem CID 130099696) has the molecular formula C7H5F4N and a molecular weight of 179.12 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,6-difluoro-5-methylpyridine.
| Compound Name | 2-(difluoromethyl)-3,6-difluoro-5-methylpyridine |
|---|---|
| PubChem CID | 130099696 |
| Molecular Formula | C7H5F4N |
| Molecular Weight | 179.12 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2-(difluoromethyl)-3,6-difluoro-5-methylpyridine |
| SMILES | Cc1cc(F)c(C(F)F)nc1F |
| InChI | InChI=1S/C7H5F4N/c1-3-2-4(8)5(6(9)10)12-7(3)11/h2,6H,1H3 |
| InChIKey | OUOPIXDZNNHNSF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|