C6H4F4N2 — CID 130099529
6-(difluoromethyl)-2,5-difluoropyridin-3-amine (PubChem CID 130099529) has the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. Its IUPAC name is 6-(difluoromethyl)-2,5-difluoropyridin-3-amine.
| Compound Name | 6-(difluoromethyl)-2,5-difluoropyridin-3-amine |
|---|---|
| PubChem CID | 130099529 |
| Molecular Formula | C6H4F4N2 |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 6-(difluoromethyl)-2,5-difluoropyridin-3-amine |
| SMILES | Nc1cc(F)c(C(F)F)nc1F |
| InChI | InChI=1S/C6H4F4N2/c7-2-1-3(11)6(10)12-4(2)5(8)9/h1,5H,11H2 |
| InChIKey | PLQJXLZPFVNKTQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|