C6H3F3IP — CID 175314658
iodo-(2,4,6-trifluorophenyl)phosphane (PubChem CID 175314658) has the molecular formula C6H3F3IP and a molecular weight of 289.96 g/mol. Its IUPAC name is iodo-(2,4,6-trifluorophenyl)phosphane.
| Compound Name | iodo-(2,4,6-trifluorophenyl)phosphane |
|---|---|
| PubChem CID | 175314658 |
| Molecular Formula | C6H3F3IP |
| Molecular Weight | 289.96 g/mol |
| Exact Mass | 289.90 |
| IUPAC Name | iodo-(2,4,6-trifluorophenyl)phosphane |
| SMILES | Fc1cc(F)c(PI)c(F)c1 |
| InChI | InChI=1S/C6H3F3IP/c7-3-1-4(8)6(11-10)5(9)2-3/h1-2,11H |
| InChIKey | QHRPSIWFHSFKEC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.96 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|