C8H7F2N — CID 117275596
4,6-difluoro-2,3-dihydro-1H-isoindole (PubChem CID 117275596) has the molecular formula C8H7F2N and a molecular weight of 155.15 g/mol. Its IUPAC name is 4,6-difluoro-2,3-dihydro-1H-isoindole.
| Compound Name | 4,6-difluoro-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 117275596 |
| Molecular Formula | C8H7F2N |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 4,6-difluoro-2,3-dihydro-1H-isoindole |
| SMILES | Fc1cc(F)c2c(c1)CNC2 |
| InChI | InChI=1S/C8H7F2N/c9-6-1-5-3-11-4-7(5)8(10)2-6/h1-2,11H,3-4H2 |
| InChIKey | FWBHIHDAOIYJOE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |