C9H9F2N — CID 99644311
(2R)-4,6-difluoro-2,3-dihydro-1H-inden-2-amine (PubChem CID 99644311) has the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. Its IUPAC name is (2R)-4,6-difluoro-2,3-dihydro-1H-inden-2-amine.
| Compound Name | (2R)-4,6-difluoro-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 99644311 |
| Molecular Formula | C9H9F2N |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (2R)-4,6-difluoro-2,3-dihydro-1H-inden-2-amine |
| SMILES | N[C@@H]1Cc2cc(F)cc(F)c2C1 |
| InChI | InChI=1S/C9H9F2N/c10-6-1-5-2-7(12)4-8(5)9(11)3-6/h1,3,7H,2,4,12H2/t7-/m1/s1 |
| InChIKey | FTGLSPDRLLNZLR-SSDOTTSWSA-N |
| XLogP | 1.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |