5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid

C11H10F2O2 — CID 177309525

IUPAC5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
SMILESO=C(O)C1CCc2c(F)cc(F)cc2C1
InChIInChI=1S/C11H10F2O2/c12-8-4-7-3-6(11(14)15)1-2-9(7)10(13)5-8/h4-6H,1-3H2,(H,14,15)
InChIKeyLOGMPRFRIKZIIY-UHFFFAOYSA-N
MW212.19 g/mol
LogP2.15
Rot. Bonds1

About 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid

5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 177309525) has the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. Its IUPAC name is 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.

Molecular Properties

Compound Name5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
PubChem CID177309525
Molecular FormulaC11H10F2O2
Molecular Weight212.19 g/mol
Exact Mass212.06
IUPAC Name5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
SMILESO=C(O)C1CCc2c(F)cc(F)cc2C1
InChIInChI=1S/C11H10F2O2/c12-8-4-7-3-6(11(14)15)1-2-9(7)10(13)5-8/h4-6H,1-3H2,(H,14,15)
InChIKeyLOGMPRFRIKZIIY-UHFFFAOYSA-N
XLogP2.15
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.19
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid?
The IUPAC name of 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CID 177309525) is 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid?
The canonical SMILES for 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is O=C(O)C1CCc2c(F)cc(F)cc2C1.
What is the InChIKey of 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid?
The InChIKey is LOGMPRFRIKZIIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2O2/c12-8-4-7-3-6(11(14)15)1-2-9(7)10(13)5-8/h4-6H,1-3H2,(H,14,15).
What are the key properties of 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid?
5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid has a molecular weight of 212.19 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 177309525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).