(1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid

C10H8F2O2 — CID 130665257

IUPAC(1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid
SMILESO=C(O)[C@@H]1CCc2c(F)cc(F)cc21
InChIInChI=1S/C10H8F2O2/c11-5-3-8-6(9(12)4-5)1-2-7(8)10(13)14/h3-4,7H,1-2H2,(H,13,14)/t7-/m1/s1
InChIKeyXMBQPAGXERQWLB-SSDOTTSWSA-N
MW198.17 g/mol
LogP2.08
Rot. Bonds1

About (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid

(1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 130665257) has the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. Its IUPAC name is (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid.

Molecular Properties

Compound Name(1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid
PubChem CID130665257
Molecular FormulaC10H8F2O2
Molecular Weight198.17 g/mol
Exact Mass198.05
IUPAC Name(1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid
SMILESO=C(O)[C@@H]1CCc2c(F)cc(F)cc21
InChIInChI=1S/C10H8F2O2/c11-5-3-8-6(9(12)4-5)1-2-7(8)10(13)14/h3-4,7H,1-2H2,(H,13,14)/t7-/m1/s1
InChIKeyXMBQPAGXERQWLB-SSDOTTSWSA-N
XLogP2.08
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.17
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid?
The IUPAC name of (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid (CID 130665257) is (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid.
What is the SMILES notation for (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid?
The canonical SMILES for (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid is O=C(O)[C@@H]1CCc2c(F)cc(F)cc21.
What is the InChIKey of (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid?
The InChIKey is XMBQPAGXERQWLB-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H8F2O2/c11-5-3-8-6(9(12)4-5)1-2-7(8)10(13)14/h3-4,7H,1-2H2,(H,13,14)/t7-/m1/s1.
What are the key properties of (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid?
(1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid has a molecular weight of 198.17 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4,6-difluoro-2,3-dihydro-1H-indene-1-carboxylic acid is sourced from PubChem (CID 130665257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).