3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid

C8H8BrNO2 — CID 83911522

IUPAC3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid
SMILESO=C(O)C1CCc2c1c[nH]c2Br
InChIInChI=1S/C8H8BrNO2/c9-7-4-1-2-5(8(11)12)6(4)3-10-7/h3,5,10H,1-2H2,(H,11,12)
InChIKeyMGVXENNKZBPHGH-UHFFFAOYSA-N
MW230.06 g/mol
LogP1.89
Rot. Bonds1

About 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid

3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid (PubChem CID 83911522) has the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. Its IUPAC name is 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid.

Molecular Properties

Compound Name3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid
PubChem CID83911522
Molecular FormulaC8H8BrNO2
Molecular Weight230.06 g/mol
Exact Mass228.97
IUPAC Name3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid
SMILESO=C(O)C1CCc2c1c[nH]c2Br
InChIInChI=1S/C8H8BrNO2/c9-7-4-1-2-5(8(11)12)6(4)3-10-7/h3,5,10H,1-2H2,(H,11,12)
InChIKeyMGVXENNKZBPHGH-UHFFFAOYSA-N
XLogP1.89
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.06
LogP ≤ 51.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid?
The IUPAC name of 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid (CID 83911522) is 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid.
What is the SMILES notation for 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid?
The canonical SMILES for 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid is O=C(O)C1CCc2c1c[nH]c2Br.
What is the InChIKey of 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid?
The InChIKey is MGVXENNKZBPHGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2/c9-7-4-1-2-5(8(11)12)6(4)3-10-7/h3,5,10H,1-2H2,(H,11,12).
What are the key properties of 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid?
3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid has a molecular weight of 230.06 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4,5,6-tetrahydrocyclopenta[c]pyrrole-6-carboxylic acid is sourced from PubChem (CID 83911522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).