C9H10FN — CID 130064496
5-fluoro-4-methyl-2,3-dihydro-1H-isoindole (PubChem CID 130064496) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is 5-fluoro-4-methyl-2,3-dihydro-1H-isoindole.
| Compound Name | 5-fluoro-4-methyl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 130064496 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 5-fluoro-4-methyl-2,3-dihydro-1H-isoindole |
| SMILES | Cc1c(F)ccc2c1CNC2 |
| InChI | InChI=1S/C9H10FN/c1-6-8-5-11-4-7(8)2-3-9(6)10/h2-3,11H,4-5H2,1H3 |
| InChIKey | KYRBTHRWSFVEMM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |