C10H10N2O — CID 130064527
4-methoxy-2,3-dihydro-1H-isoindole-5-carbonitrile (PubChem CID 130064527) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 4-methoxy-2,3-dihydro-1H-isoindole-5-carbonitrile.
| Compound Name | 4-methoxy-2,3-dihydro-1H-isoindole-5-carbonitrile |
|---|---|
| PubChem CID | 130064527 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 4-methoxy-2,3-dihydro-1H-isoindole-5-carbonitrile |
| SMILES | COc1c(C#N)ccc2c1CNC2 |
| InChI | InChI=1S/C10H10N2O/c1-13-10-7(4-11)2-3-8-5-12-6-9(8)10/h2-3,12H,5-6H2,1H3 |
| InChIKey | MTJUKOLQAUUMRG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |