C6H3F3OP+ — CID 154124883
oxo-(2,4,6-trifluorophenyl)phosphanium (PubChem CID 154124883) has the molecular formula C6H3F3OP+ and a molecular weight of 179.06 g/mol. Its IUPAC name is oxo-(2,4,6-trifluorophenyl)phosphanium.
| Compound Name | oxo-(2,4,6-trifluorophenyl)phosphanium |
|---|---|
| PubChem CID | 154124883 |
| Molecular Formula | C6H3F3OP+ |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | oxo-(2,4,6-trifluorophenyl)phosphanium |
| SMILES | O=[PH+]c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C6H2F3OP/c7-3-1-4(8)6(11-10)5(9)2-3/h1-2H/p+1 |
| InChIKey | JUFSGFULLXQXOK-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|