About oxo-(2,4,6-trifluorophenyl)phosphanium
oxo-(2,4,6-trifluorophenyl)phosphanium (PubChem CID 154124883) has the molecular formula C6H3F3OP+
and a molecular weight of 179.06 g/mol. Its IUPAC name is oxo-(2,4,6-trifluorophenyl)phosphanium.
Molecular Properties
| Compound Name | oxo-(2,4,6-trifluorophenyl)phosphanium |
| PubChem CID | 154124883 |
| Molecular Formula | C6H3F3OP+ |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | oxo-(2,4,6-trifluorophenyl)phosphanium |
| SMILES | O=[PH+]c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C6H2F3OP/c7-3-1-4(8)6(11-10)5(9)2-3/h1-2H/p+1 |
| InChIKey | JUFSGFULLXQXOK-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-(2,4,6-trifluorophenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-(2,4,6-trifluorophenyl)phosphanium?
The IUPAC name of oxo-(2,4,6-trifluorophenyl)phosphanium (CID 154124883) is oxo-(2,4,6-trifluorophenyl)phosphanium.
What is the SMILES notation for oxo-(2,4,6-trifluorophenyl)phosphanium?
The canonical SMILES for oxo-(2,4,6-trifluorophenyl)phosphanium is O=[PH+]c1c(F)cc(F)cc1F.
What is the InChIKey of oxo-(2,4,6-trifluorophenyl)phosphanium?
The InChIKey is JUFSGFULLXQXOK-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H2F3OP/c7-3-1-4(8)6(11-10)5(9)2-3/h1-2H/p+1.
What are the key properties of oxo-(2,4,6-trifluorophenyl)phosphanium?
oxo-(2,4,6-trifluorophenyl)phosphanium has a molecular weight of 179.06 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-(2,4,6-trifluorophenyl)phosphanium is sourced from PubChem (CID 154124883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).