C7H4F3NO — CID 19027811
N-(2,4,6-trifluorophenyl)formamide (PubChem CID 19027811) has the molecular formula C7H4F3NO and a molecular weight of 175.11 g/mol. Its IUPAC name is N-(2,4,6-trifluorophenyl)formamide.
| Compound Name | N-(2,4,6-trifluorophenyl)formamide |
|---|---|
| PubChem CID | 19027811 |
| Molecular Formula | C7H4F3NO |
| Molecular Weight | 175.11 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | N-(2,4,6-trifluorophenyl)formamide |
| SMILES | O=CNc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C7H4F3NO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-3H,(H,11,12) |
| InChIKey | ADSHTMHWRKUFAN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.11 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|