C8H7F2NO — CID 144501895
N-(2,6-difluoro-4-methylphenyl)formamide (PubChem CID 144501895) has the molecular formula C8H7F2NO and a molecular weight of 171.15 g/mol. Its IUPAC name is N-(2,6-difluoro-4-methylphenyl)formamide.
| Compound Name | N-(2,6-difluoro-4-methylphenyl)formamide |
|---|---|
| PubChem CID | 144501895 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N-(2,6-difluoro-4-methylphenyl)formamide |
| SMILES | Cc1cc(F)c(NC=O)c(F)c1 |
| InChI | InChI=1S/C8H7F2NO/c1-5-2-6(9)8(11-4-12)7(10)3-5/h2-4H,1H3,(H,11,12) |
| InChIKey | IECILYNRCFUMGE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|