C7H4Cl2FNO — CID 168654029
N-(2,4-dichloro-6-fluorophenyl)formamide (PubChem CID 168654029) has the molecular formula C7H4Cl2FNO and a molecular weight of 208.02 g/mol. Its IUPAC name is N-(2,4-dichloro-6-fluorophenyl)formamide.
| Compound Name | N-(2,4-dichloro-6-fluorophenyl)formamide |
|---|---|
| PubChem CID | 168654029 |
| Molecular Formula | C7H4Cl2FNO |
| Molecular Weight | 208.02 g/mol |
| Exact Mass | 206.97 |
| IUPAC Name | N-(2,4-dichloro-6-fluorophenyl)formamide |
| SMILES | O=CNc1c(F)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl2FNO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-3H,(H,11,12) |
| InChIKey | JUNSKUKCSWCDTI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.02 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|