C7H5ClF2N2O — CID 59083606
(4-chloro-2,6-difluorophenyl)urea (PubChem CID 59083606) has the molecular formula C7H5ClF2N2O and a molecular weight of 206.58 g/mol. Its IUPAC name is (4-chloro-2,6-difluorophenyl)urea.
| Compound Name | (4-chloro-2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 59083606 |
| Molecular Formula | C7H5ClF2N2O |
| Molecular Weight | 206.58 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | (4-chloro-2,6-difluorophenyl)urea |
| SMILES | NC(=O)Nc1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C7H5ClF2N2O/c8-3-1-4(9)6(5(10)2-3)12-7(11)13/h1-2H,(H3,11,12,13) |
| InChIKey | LFDJPZFGBLLASL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |