C7H4Cl2INO — CID 168654556
N-(2,4-dichloro-6-iodophenyl)formamide (PubChem CID 168654556) has the molecular formula C7H4Cl2INO and a molecular weight of 315.93 g/mol. Its IUPAC name is N-(2,4-dichloro-6-iodophenyl)formamide.
| Compound Name | N-(2,4-dichloro-6-iodophenyl)formamide |
|---|---|
| PubChem CID | 168654556 |
| Molecular Formula | C7H4Cl2INO |
| Molecular Weight | 315.93 g/mol |
| Exact Mass | 314.87 |
| IUPAC Name | N-(2,4-dichloro-6-iodophenyl)formamide |
| SMILES | O=CNc1c(Cl)cc(Cl)cc1I |
| InChI | InChI=1S/C7H4Cl2INO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-3H,(H,11,12) |
| InChIKey | VHCVIBAAEVCRLN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.93 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|