C14H8ClF3N2O2 — CID 166842286
2-chloro-5-formamido-N-(2,4,6-trifluorophenyl)benzamide (PubChem CID 166842286) has the molecular formula C14H8ClF3N2O2 and a molecular weight of 328.68 g/mol. Its IUPAC name is 2-chloro-5-formamido-N-(2,4,6-trifluorophenyl)benzamide.
| Compound Name | 2-chloro-5-formamido-N-(2,4,6-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 166842286 |
| Molecular Formula | C14H8ClF3N2O2 |
| Molecular Weight | 328.68 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-chloro-5-formamido-N-(2,4,6-trifluorophenyl)benzamide |
| SMILES | O=CNc1ccc(Cl)c(C(=O)Nc2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C14H8ClF3N2O2/c15-10-2-1-8(19-6-21)5-9(10)14(22)20-13-11(17)3-7(16)4-12(13)18/h1-6H,(H,19,21)(H,20,22) |
| InChIKey | UDUKLDSMIZTGCC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|