C17H14ClF3N3O3P — CID 134441715
2-chloro-N-[2,4-difluoro-5-(2-fluoropropanoylamino)-3-phosphanylphenyl]-5-formamidobenzamide (PubChem CID 134441715) has the molecular formula C17H14ClF3N3O3P and a molecular weight of 431.74 g/mol. Its IUPAC name is 2-chloro-N-[2,4-difluoro-5-(2-fluoropropanoylamino)-3-phosphanylphenyl]-5-formamidobenzamide.
| Compound Name | 2-chloro-N-[2,4-difluoro-5-(2-fluoropropanoylamino)-3-phosphanylphenyl]-5-formamidobenzamide |
|---|---|
| PubChem CID | 134441715 |
| Molecular Formula | C17H14ClF3N3O3P |
| Molecular Weight | 431.74 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2-chloro-N-[2,4-difluoro-5-(2-fluoropropanoylamino)-3-phosphanylphenyl]-5-formamidobenzamide |
| SMILES | CC(F)C(=O)Nc1cc(NC(=O)c2cc(NC=O)ccc2Cl)c(F)c(P)c1F |
| InChI | InChI=1S/C17H14ClF3N3O3P/c1-7(19)16(26)23-11-5-12(14(21)15(28)13(11)20)24-17(27)9-4-8(22-6-25)2-3-10(9)18/h2-7H,28H2,1H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | BZHRVMYXOZEVQQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|