C17H16ClIN2O2 — CID 1297056
2-chloro-5-iodo-N-[4-(2-methylpropanoylamino)phenyl]benzamide (PubChem CID 1297056) has the molecular formula C17H16ClIN2O2 and a molecular weight of 442.68 g/mol. Its IUPAC name is 2-chloro-5-iodo-N-[4-(2-methylpropanoylamino)phenyl]benzamide.
| Compound Name | 2-chloro-5-iodo-N-[4-(2-methylpropanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 1297056 |
| Molecular Formula | C17H16ClIN2O2 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 2-chloro-5-iodo-N-[4-(2-methylpropanoylamino)phenyl]benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(NC(=O)c2cc(I)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClIN2O2/c1-10(2)16(22)20-12-4-6-13(7-5-12)21-17(23)14-9-11(19)3-8-15(14)18/h3-10H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | QWNWBKAXWXYALJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|