C22H17Cl2IN2O2S — CID 21170590
2,4-dichloro-N-[4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanylphenyl]benzamide (PubChem CID 21170590) has the molecular formula C22H17Cl2IN2O2S and a molecular weight of 571.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 21170590 |
| Molecular Formula | C22H17Cl2IN2O2S |
| Molecular Weight | 571.27 g/mol |
| Exact Mass | 569.94 |
| IUPAC Name | 2,4-dichloro-N-[4-[1-(4-iodoanilino)-1-oxopropan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C22H17Cl2IN2O2S/c1-13(21(28)26-16-5-3-15(25)4-6-16)30-18-9-7-17(8-10-18)27-22(29)19-11-2-14(23)12-20(19)24/h2-13H,1H3,(H,26,28)(H,27,29) |
| InChIKey | JQHSVBPPLPEQOE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.27 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|