C7H5FI2 — CID 119020477
5-fluoro-1,2-diiodo-3-methylbenzene (PubChem CID 119020477) has the molecular formula C7H5FI2 and a molecular weight of 361.92 g/mol. Its IUPAC name is 5-fluoro-1,2-diiodo-3-methylbenzene.
| Compound Name | 5-fluoro-1,2-diiodo-3-methylbenzene |
|---|---|
| PubChem CID | 119020477 |
| Molecular Formula | C7H5FI2 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.85 |
| IUPAC Name | 5-fluoro-1,2-diiodo-3-methylbenzene |
| SMILES | Cc1cc(F)cc(I)c1I |
| InChI | InChI=1S/C7H5FI2/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,1H3 |
| InChIKey | FNKLGXBEIZSMTO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|