C17H17F2IO2 — CID 154029735
5-fluoro-2-[3-(4-fluoro-2-iodophenoxy)propoxy]-1,3-dimethylbenzene (PubChem CID 154029735) has the molecular formula C17H17F2IO2 and a molecular weight of 418.22 g/mol. Its IUPAC name is 5-fluoro-2-[3-(4-fluoro-2-iodophenoxy)propoxy]-1,3-dimethylbenzene.
| Compound Name | 5-fluoro-2-[3-(4-fluoro-2-iodophenoxy)propoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 154029735 |
| Molecular Formula | C17H17F2IO2 |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 5-fluoro-2-[3-(4-fluoro-2-iodophenoxy)propoxy]-1,3-dimethylbenzene |
| SMILES | Cc1cc(F)cc(C)c1OCCCOc1ccc(F)cc1I |
| InChI | InChI=1S/C17H17F2IO2/c1-11-8-14(19)9-12(2)17(11)22-7-3-6-21-16-5-4-13(18)10-15(16)20/h4-5,8-10H,3,6-7H2,1-2H3 |
| InChIKey | YPYWRKIXVRYJID-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|