C9H6F5IO — CID 175686923
4-fluoro-2-iodo-1-(2,2,3,3-tetrafluoropropoxy)benzene (PubChem CID 175686923) has the molecular formula C9H6F5IO and a molecular weight of 352.04 g/mol. Its IUPAC name is 4-fluoro-2-iodo-1-(2,2,3,3-tetrafluoropropoxy)benzene.
| Compound Name | 4-fluoro-2-iodo-1-(2,2,3,3-tetrafluoropropoxy)benzene |
|---|---|
| PubChem CID | 175686923 |
| Molecular Formula | C9H6F5IO |
| Molecular Weight | 352.04 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 4-fluoro-2-iodo-1-(2,2,3,3-tetrafluoropropoxy)benzene |
| SMILES | Fc1ccc(OCC(F)(F)C(F)F)c(I)c1 |
| InChI | InChI=1S/C9H6F5IO/c10-5-1-2-7(6(15)3-5)16-4-9(13,14)8(11)12/h1-3,8H,4H2 |
| InChIKey | XXZUASJWFUZCSK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.04 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|