About CID 155601706
CID 155601706 (PubChem CID 155601706) has the molecular formula C9H9FIOSi
and a molecular weight of 307.16 g/mol.
Molecular Properties
| Compound Name | CID 155601706 |
| PubChem CID | 155601706 |
| Molecular Formula | C9H9FIOSi |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | — |
| SMILES | Fc1ccc(OCCC[Si])c(I)c1 |
| InChI | InChI=1S/C9H9FIOSi/c10-7-2-3-9(8(11)6-7)12-4-1-5-13/h2-3,6H,1,4-5H2 |
| InChIKey | SSHMWKJQEJRVAY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 155601706 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155601706?
The IUPAC name of CID 155601706 (CID 155601706) is not available.
What is the SMILES notation for CID 155601706?
The canonical SMILES for CID 155601706 is Fc1ccc(OCCC[Si])c(I)c1.
What is the InChIKey of CID 155601706?
The InChIKey is SSHMWKJQEJRVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FIOSi/c10-7-2-3-9(8(11)6-7)12-4-1-5-13/h2-3,6H,1,4-5H2.
What are the key properties of CID 155601706?
CID 155601706 has a molecular weight of 307.16 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155601706 is sourced from PubChem (CID 155601706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).