C10H8F5NOS — CID 43658096
3-fluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarbothioamide (PubChem CID 43658096) has the molecular formula C10H8F5NOS and a molecular weight of 285.24 g/mol. Its IUPAC name is 3-fluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarbothioamide.
| Compound Name | 3-fluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 43658096 |
| Molecular Formula | C10H8F5NOS |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 3-fluoro-4-(2,2,3,3-tetrafluoropropoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCC(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C10H8F5NOS/c11-6-3-5(8(16)18)1-2-7(6)17-4-10(14,15)9(12)13/h1-3,9H,4H2,(H2,16,18) |
| InChIKey | XRZJYTZRIIPSRK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|