C17H18FNOS — CID 107665785
3-fluoro-4-[(2,4,6-trimethylphenyl)methoxy]benzenecarbothioamide (PubChem CID 107665785) has the molecular formula C17H18FNOS and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-fluoro-4-[(2,4,6-trimethylphenyl)methoxy]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[(2,4,6-trimethylphenyl)methoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 107665785 |
| Molecular Formula | C17H18FNOS |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-fluoro-4-[(2,4,6-trimethylphenyl)methoxy]benzenecarbothioamide |
| SMILES | Cc1cc(C)c(COc2ccc(C(N)=S)cc2F)c(C)c1 |
| InChI | InChI=1S/C17H18FNOS/c1-10-6-11(2)14(12(3)7-10)9-20-16-5-4-13(17(19)21)8-15(16)18/h4-8H,9H2,1-3H3,(H2,19,21) |
| InChIKey | UOMBDKSLDNTDGC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|