C11H11FN4OS — CID 107665921
3-fluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenecarbothioamide (PubChem CID 107665921) has the molecular formula C11H11FN4OS and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-fluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 107665921 |
| Molecular Formula | C11H11FN4OS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-fluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenecarbothioamide |
| SMILES | Cn1cc(COc2ccc(C(N)=S)cc2F)nn1 |
| InChI | InChI=1S/C11H11FN4OS/c1-16-5-8(14-15-16)6-17-10-3-2-7(11(13)18)4-9(10)12/h2-5H,6H2,1H3,(H2,13,18) |
| InChIKey | JEONPMQJOBMBSZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|