C10H10F2N4O3S — CID 107044380
2,3-difluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenesulfonamide (PubChem CID 107044380) has the molecular formula C10H10F2N4O3S and a molecular weight of 304.28 g/mol. Its IUPAC name is 2,3-difluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenesulfonamide.
| Compound Name | 2,3-difluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 107044380 |
| Molecular Formula | C10H10F2N4O3S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2,3-difluoro-4-[(1-methyltriazol-4-yl)methoxy]benzenesulfonamide |
| SMILES | Cn1cc(COc2ccc(S(N)(=O)=O)c(F)c2F)nn1 |
| InChI | InChI=1S/C10H10F2N4O3S/c1-16-4-6(14-15-16)5-19-7-2-3-8(20(13,17)18)10(12)9(7)11/h2-4H,5H2,1H3,(H2,13,17,18) |
| InChIKey | SQUDQDXWRXRJRN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |