C11H11F2N3O3S — CID 82870156
2,3-difluoro-4-[(1-methylpyrazol-3-yl)methoxy]benzenesulfonamide (PubChem CID 82870156) has the molecular formula C11H11F2N3O3S and a molecular weight of 303.29 g/mol. Its IUPAC name is 2,3-difluoro-4-[(1-methylpyrazol-3-yl)methoxy]benzenesulfonamide.
| Compound Name | 2,3-difluoro-4-[(1-methylpyrazol-3-yl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82870156 |
| Molecular Formula | C11H11F2N3O3S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2,3-difluoro-4-[(1-methylpyrazol-3-yl)methoxy]benzenesulfonamide |
| SMILES | Cn1ccc(COc2ccc(S(N)(=O)=O)c(F)c2F)n1 |
| InChI | InChI=1S/C11H11F2N3O3S/c1-16-5-4-7(15-16)6-19-8-2-3-9(20(14,17)18)11(13)10(8)12/h2-5H,6H2,1H3,(H2,14,17,18) |
| InChIKey | RKDIYVBNHYKINJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |