C11H12N4O5S — CID 107044349
2-[(1-methyltriazol-4-yl)methoxy]-5-sulfamoylbenzoic acid (PubChem CID 107044349) has the molecular formula C11H12N4O5S and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-[(1-methyltriazol-4-yl)methoxy]-5-sulfamoylbenzoic acid.
| Compound Name | 2-[(1-methyltriazol-4-yl)methoxy]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 107044349 |
| Molecular Formula | C11H12N4O5S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-[(1-methyltriazol-4-yl)methoxy]-5-sulfamoylbenzoic acid |
| SMILES | Cn1cc(COc2ccc(S(N)(=O)=O)cc2C(=O)O)nn1 |
| InChI | InChI=1S/C11H12N4O5S/c1-15-5-7(13-14-15)6-20-10-3-2-8(21(12,18)19)4-9(10)11(16)17/h2-5H,6H2,1H3,(H,16,17)(H2,12,18,19) |
| InChIKey | CPJKHTSECUAAJA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |