C11H12BrN5O2 — CID 107043336
5-bromo-N'-hydroxy-2-[(1-methyltriazol-4-yl)methoxy]benzenecarboximidamide (PubChem CID 107043336) has the molecular formula C11H12BrN5O2 and a molecular weight of 326.15 g/mol. Its IUPAC name is 5-bromo-N'-hydroxy-2-[(1-methyltriazol-4-yl)methoxy]benzenecarboximidamide.
| Compound Name | 5-bromo-N'-hydroxy-2-[(1-methyltriazol-4-yl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 107043336 |
| Molecular Formula | C11H12BrN5O2 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-bromo-N'-hydroxy-2-[(1-methyltriazol-4-yl)methoxy]benzenecarboximidamide |
| SMILES | Cn1cc(COc2ccc(Br)cc2/C(N)=N/O)nn1 |
| InChI | InChI=1S/C11H12BrN5O2/c1-17-5-8(14-16-17)6-19-10-3-2-7(12)4-9(10)11(13)15-18/h2-5,18H,6H2,1H3,(H2,13,15) |
| InChIKey | KHYSGMANORSKNC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|