C12H14BrN3O2 — CID 107043932
(1S)-1-[4-bromo-2-[(1-methyltriazol-4-yl)methoxy]phenyl]ethanol (PubChem CID 107043932) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is (1S)-1-[4-bromo-2-[(1-methyltriazol-4-yl)methoxy]phenyl]ethanol.
| Compound Name | (1S)-1-[4-bromo-2-[(1-methyltriazol-4-yl)methoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107043932 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | (1S)-1-[4-bromo-2-[(1-methyltriazol-4-yl)methoxy]phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(Br)cc1OCc1cn(C)nn1 |
| InChI | InChI=1S/C12H14BrN3O2/c1-8(17)11-4-3-9(13)5-12(11)18-7-10-6-16(2)15-14-10/h3-6,8,17H,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | UKGWKXWVDFXCJQ-QMMMGPOBSA-N |
| XLogP | 2.21 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |